Browse papers
A

Group A - Multiple Choice Questions

Rewrite the correct options of each questions in your answer sheet.

11 questions·1 marks each
1mcq1 marks

Phenol is heated with CHCl3CHCl_{3} and aq. KOH than produce salicylaldelyde. This reaction is called.

  • A

    Friedel-crafts reaction

  • B

    Rosenmund's reaction

  • C

    Reimer-Tiemann reaction

  • D

    Carbyalamine reaction

Correct answer: C

Reimer-Tiemann reaction

The reaction of phenol with chloroform (CHCl3CHCl_3) and aqueous potassium hydroxide (KOHKOH) to introduce a formyl group ortho to the hydroxyl group, yielding salicylaldehyde, is known as the Reimer-Tiemann reaction.

phenolreimer-tiemann-reaction
2mcq1 marks

Which of the following reaction is used to distinguish carboxylic acid with other organic compound?

  • A

    reaction with sodium metal

  • B

    reaction with bycarbonate

  • C

    reaction with magnesium metal

  • D

    reaction with chlorine

Correct answer: B

reaction with bycarbonate

Carboxylic acids react with sodium bicarbonate (NaHCO3NaHCO_3) to evolve carbon dioxide gas with brisk effervescence, a reaction not typically shown by simpler alcohols or phenols (except highly nitrated ones), making it a standard diagnostic test.

carboxylic-acidbicarbonate-test
3mcq1 marks

Silver gets tarnished in air due the reaction with

  • A

    O2O_{2}

  • B

    CO2CO_{2}

  • C

    H2OH_{2}O

  • D

    H2SH_{2}S

Correct answer: D

H2SH_{2}S

Silver reacts with trace amounts of hydrogen sulfide (H2SH_2S) present in the air to form a black layer of silver sulfide (Ag2SAg_2S), which causes tarnishing.

silvertarnishing
4mcq1 marks

Lithophone is a mixture of

  • A

    ZnSO4 and BaSO4ZnSO_{4}\text{ and }BaSO_{4}

  • B

    ZnS and BaSO4ZnS\text{ and }BaSO_{4}

  • C

    ZnCO3 and BaCO3ZnCO_{3}\text{ and }BaCO_{3}

  • D

    ZnS and Na2SO4ZnS\text{ and }Na_{2}SO_{4}

Correct answer: B

ZnS and BaSO4ZnS\text{ and }BaSO_{4}

Lithopone is a white pigment consisting of a mixture of zinc sulfide (ZnSZnS) and barium sulfate (BaSO4BaSO_4), typically prepared by coprecipitation.

lithoponezinc-compounds
5mcq1 marks

The correct decreasing order of acidic strength of 0.1m solution of following acids, is

  • A

    F2CHCOOH>FCH2COOH>ClCH2COOH>CH3COOHF_{2}CHCOOH>FCH_{2}COOH>ClCH_{2}COOH>CH_{3}COOH

  • B

    FCH2COOH>F2CHCOOH>ClCH2COOH>CH3COOHFCH_{2}COOH>F_{2}CHCOOH>ClCH_{2}COOH>CH_{3}COOH

  • C

    ClCH2COOH>FCH2COOH>F2CHCOOH>CH3COOHClCH_{2}COOH>FCH_{2}COOH>F_{2}CHCOOH>CH_{3}COOH

  • D

    CH3COOH>ClCH2COOH>FCH2COOH>F2CHCOOHCH_{3}COOH>ClCH_{2}COOH>FCH_{2}COOH>F_{2}CHCOOH

Correct answer: A

F2CHCOOH>FCH2COOH>ClCH2COOH>CH3COOHF_{2}CHCOOH>FCH_{2}COOH>ClCH_{2}COOH>CH_{3}COOH

The electron-withdrawing inductive effect (I-I effect) increases the acidity of carboxylic acids. Fluorine is more electronegative than chlorine, and having two fluorine atoms exerts a stronger withdrawal effect than one. Thus, the acidity follows the order: F2CHCOOH>FCH2COOH>ClCH2COOH>CH3COOHF_2CHCOOH > FCH_2COOH > ClCH_2COOH > CH_3COOH.

acidic-strengthinductive-effect
6mcq1 marks

Another name of grain alcohol is

  • A

    wood alcohol

  • B

    methyl alcohol

  • C

    ethyl alcohol

  • D

    propyl alcohol

Correct answer: C

ethyl alcohol

Ethanol (ethyl alcohol) is commonly referred to as grain alcohol because it is frequently produced via the fermentation of grains like corn, wheat, or barley.

grain-alcoholethanol
7mcq1 marks

Primary and secondary amines are distinguished by.

  • A

    Br2/KOHBr_{2}/KOH

  • B

    HClOHClO

  • C

    HNO2HNO_{2}

  • D

    NH3NH_{3}

Correct answer: C

HNO2HNO_{2}

Nitrous acid (HNO2HNO_2) reacts with primary aliphatic amines to produce alcohol accompanied by the evolution of nitrogen gas bubbles. With secondary amines, it forms a yellow, oily nitrosamine compound, providing an easy distinction.

aminesnitrous-acid
8mcq1 marks

The specific rate constant of 1 order reaction depends on

  • A

    concentration of reactant

  • B

    temperature

  • C

    time

  • D

    concentration of product

Correct answer: B

temperature

The specific rate constant (kk) for a reaction is independent of the concentration of reactants or products and independent of elapsed time, but it changes significantly with a change in temperature according to the Arrhenius equation.

chemical-kineticsrate-constant
9mcq1 marks

Calculate number of H ion present in 1ml of a solution whose pH=13pH=13

  • A

    6.02×1076.02\times10^{7}

  • B

    6.02×1086.02\times10^{8}

  • C

    6.02×1096.02\times10^{9}

  • D

    6.02×10106.02\times10^{10}

Correct answer: A

6.02×1076.02\times10^{7}

Given pH=13pH = 13, the concentration of H+H^+ ions is [H+]=10pH=1013mol/L[H^+] = 10^{-pH} = 10^{-13}\,\text{mol/L}. In 1mL1\,\text{mL} (103L10^{-3}\,\text{L}), the number of moles of H+H^+ ions is 1013mol/L×103L=1016mol10^{-13}\,\text{mol/L} \times 10^{-3}\,\text{L} = 10^{-16}\,\text{mol}. The total number of H+H^+ ions is 1016mol×6.022×1023ions/mol=6.022×107ions10^{-16}\,\text{mol} \times 6.022 \times 10^{23}\,\text{ions/mol} = 6.022 \times 10^{7}\,\text{ions}.

ionic-equilibriumph-scale
10mcq1 marks

What will be the value of ΔS\Delta S for conversion of ice into water when they are in equilibrium? (ΔH=6KJ/mol)(\Delta H=6\,\text{KJ/mol})

  • A

    0.022KJ K1mol10.022\,\text{KJ K}^{-1}\text{mol}^{-1}

  • B

    0.025KJ K1mol10.025\,\text{KJ K}^{-1}\text{mol}^{-1}

  • C

    0.027KJ K1mol10.027\,\text{KJ K}^{-1}\text{mol}^{-1}

  • D

    0.029KJ K1mol10.029\,\text{KJ K}^{-1}\text{mol}^{-1}

Correct answer: A

0.022KJ K1mol10.022\,\text{KJ K}^{-1}\text{mol}^{-1}

At normal equilibrium melting point, ice and water coexist at T=0C=273.15KT = 0^\circ\text{C} = 273.15\,\text{K}. ΔS=ΔHT=6KJ/mol273.15K0.02196KJ K1mol10.022KJ K1mol1\Delta S = \dfrac{\Delta H}{T} = \dfrac{6\,\text{KJ/mol}}{273.15\,\text{K}} \approx 0.02196\,\text{KJ K}^{-1}\text{mol}^{-1} \approx 0.022\,\text{KJ K}^{-1}\text{mol}^{-1}.

thermodynamicsentropy
11mcq1 marks

Find out the volume of water to be added to 20ml of 2N HCl to make it exactly decinormal.

  • A

    375 ml

  • B

    380 ml

  • C

    385 ml

  • D

    390 ml

Correct answer: B

380 ml

Using the dilution equation N1V1=N2V2N_1V_1 = N_2V_2: Here N1=2NN_1 = 2\,\text{N}, V1=20mLV_1 = 20\,\text{mL}, and decinormal means N2=0.1NN_2 = 0.1\,\text{N}. 2×20=0.1×V2    V2=400.1=400mL2 \times 20 = 0.1 \times V_2 \implies V_2 = \dfrac{40}{0.1} = 400\,\text{mL}. Volume of water to be added = Final volume (V2V_2) - Initial volume (V1V_1) = 40020=380mL400 - 20 = 380\,\text{mL}.

volumetric-analysisnormality
B

Group B - Short Answer Questions

Attempt all the questions.

10 questions·5 marks each
12short5 marks

Give an example of each of the following reaction i) Coupling reaction ii) Hydroboration oxidation iii) Clemmensen's reduction iv) Fehling test v) Carbonylation reaction

i) Coupling reaction: Benzene diazonium chloride reacts with phenol in a mildly alkaline medium to yield p-hydroxyazobenzene (an orange dye): C6H5N2+Cl+C6H5OHC6H5N=NC6H4OH+HClC_6H_5N_2^+Cl^- + C_6H_5OH \rightarrow C_6H_5-N=N-C_6H_4-OH + HCl

ii) Hydroboration oxidation: Propene reacts with diborane (BH3/THFBH_3/THF) followed by alkaline hydrogen peroxide (H2O2/OHH_2O_2/OH^-) to yield propan-1-ol: CH3CH=CH22.H2O2,OH1.BH3CH3CH2CH2OHCH_3-CH=CH_2 \xrightarrow[2. H_2O_2, OH^-]{1. BH_3} CH_3-CH_2-CH_2-OH

iii) Clemmensen's reduction: Ethanal is reduced with zinc amalgam (Zn/HgZn/Hg) and concentrated HClHCl to form ethane: CH3CHO+4[H]ZnHg/conc.HClCH3CH3+H2OCH_3CHO + 4[H] \xrightarrow{Zn-Hg / conc. HCl} CH_3-CH_3 + H_2O

iv) Fehling test: Aliphatic aldehydes like ethanal reduce Fehling's solution to form a red precipitate of cuprous oxide (Cu2OCu_2O): CH3CHO+2Cu2++5OHCH3COO+Cu2O+3H2OCH_3CHO + 2Cu^{2+} + 5OH^- \rightarrow CH_3COO^- + Cu_2O\downarrow + 3H_2O

v) Carbonylation reaction: Methanol reacts with carbon monoxide in the presence of a rhodium catalyst to produce acetic acid: CH3OH+CORh catalystCH3COOHCH_3OH + CO \xrightarrow{\text{Rh catalyst}} CH_3COOH

organic-reactionsnamed-reactions
13short5 marks

An organic compound (A) having molecular formula C4H8O2C_{4}H_{8}O_{2} undergoes acid hydrolysis to produce a carboxylic acid (B) and an alcohol (C). When (B) is reduced with LiAlH4LiAlH_{4} then the alcohol (C) is produced. i) Draw molecular structure of (A) (B) and (C) with proper reaction. ii) What products would you expect when (A) is reduced with LiAlH4LiAlH_{4}?

i) Since compound (A) with formula C4H8O2C_4H_8O_2 yields an acid (B) and an alcohol (C) upon hydrolysis, it must be an ester. Reduction of acid (B) with LiAlH4LiAlH_4 produces the exact same alcohol (C), meaning both the carboxylic acid segment and the alcohol portion contain equal number of carbon atoms (2 carbons each). Thus:

  • Compound (A) is Ethyl ethanoate: CH3COOCH2CH3CH_3COOCH_2CH_3
  • Compound (B) is Ethanoic acid: CH3COOHCH_3COOH
  • Compound (C) is Ethanol: CH3CH2OHCH_3CH_2OH

Reaction of Hydrolysis: CH3COOCH2CH3+H2OH+CH3COOH+CH3CH2OHCH_3COOCH_2CH_3 + H_2O \xrightarrow{H^+} CH_3COOH + CH_3CH_2OH

Reaction of Reduction of B: CH3COOH2.H2O1.LiAlH4CH3CH2OHCH_3COOH \xrightarrow[2. H_2O]{1. LiAlH_4} CH_3CH_2OH

ii) When ester (A) is reduced with LiAlH4LiAlH_4, it undergoes reductive cleavage to produce two molecules of ethanol: CH3COOCH2CH32.H2O1.LiAlH42CH3CH2OHCH_3COOCH_2CH_3 \xrightarrow[2. H_2O]{1. LiAlH_4} 2 CH_3CH_2OH

estershydrolysisreduction
14short5 marks

You are given a bottle containing a mixture of RNH2R-NH_{2} R2NHR_{2}NH and R3NR_{3}N How would you apply Hoffmann's method to separate each compound in pure state ?

In Hoffmann's method, diethyl oxalate is added to the mixture of primary (RNH2R-NH_2), secondary (R2NHR_2NH), and tertiary (R3NR_3N) amines:

  1. Primary amine reacts to form a solid dialkyl oxamide: (COOC2H5)2+2RNH2(CONHR)2+2C2H5OH(COOC_2H_5)_2 + 2R-NH_2 \rightarrow (CONHR)_2\downarrow + 2C_2H_5OH
  2. Secondary amine reacts to form a liquid oxamic ester: (COOC2H5)2+R2NHCOONR2COOC2H5+C2H5OH(COOC_2H_5)_2 + R_2NH \rightarrow COONR_2-COOC_2H_5 + C_2H_5OH
  3. Tertiary amine does not react due to the absence of a replaceable hydrogen atom on nitrogen.

Separation Process:

  • The unreacted tertiary amine (R3NR_3N) is separated out by simple distillation because it has a lower boiling point.
  • The residue containing the solid dialkyl oxamide and liquid oxamic ester is filtered. The solid oxamide is separated from the liquid ester.
  • The separated dialkyl oxamide is heated with a strong alkali (like aqueous KOHKOH) to recover the pure primary amine via distillation: (CONHR)2+2KOH(COOK)2+2RNH2(CONHR)_2 + 2KOH \rightarrow (COOK)_2 + 2R-NH_2\uparrow
  • The liquid oxamic ester is similarly distilled with a strong alkali to recover the pure secondary amine: COONR2COOC2H5+2KOH(COOK)2+R2NH+C2H5OHCOONR_2-COOC_2H_5 + 2KOH \rightarrow (COOK)_2 + R_2NH\uparrow + C_2H_5OH
amineshoffmanns-method
15short5 marks

Describe rusting theory of Iron. Name the process of preventing iron from rusting.

According to the electrochemical theory of rusting, a drop of water containing dissolved O2O_2 and CO2CO_2 acts as a miniature electrochemical cell on the iron surface.

  • At Anode: Iron undergoes oxidation: FeFe2++2eFe \rightarrow Fe^{2+} + 2e^-
  • At Cathode: Electrons migrate through the metal to another point where oxygen is reduced in the presence of H+H^+ ions (from H2CO3H_2CO_3): O2+4H++4e2H2OO_2 + 4H^+ + 4e^- \rightarrow 2H_2O
  • Overall reaction: 2Fe+O2+4H+2Fe2++2H2O2Fe + O_2 + 4H^+ \rightarrow 2Fe^{2+} + 2H_2O

The Fe2+Fe^{2+} ions are further oxidized by atmospheric oxygen to form hydrated ferric oxide, which is rust: 4Fe2++O2+4H2O+2xH2O2Fe2O3xH2O+8H+4Fe^{2+} + O_2 + 4H_2O + 2xH_2O \rightarrow 2Fe_2O_3\cdot xH_2O\downarrow + 8H^+

Prevention Processes: Rusting can be prevented by methods like Galvanization (coating iron with a protective layer of zinc), sacrificial protection, cathodic protection, painting, or electroplating.

corrosionrusting-of-iron
16short5 marks

i) What is meant by transition metal? ii) Justify giving proper reason. a) Transition metals mostly form coloured compounds.) Zinc is regarded as non-typical transition metal. iii) Draw splitting of d-orbital in octahedral field showing eg set and t₂g set.

i) Transition metal: A transition metal is defined as an element that forms at least one stable ion containing a partially filled or incomplete d-subshell.

ii) a) Coloured compounds: Transition metals possess partially filled d-orbitals. When ligands approach, the degenerate d-orbitals split into groups of different energy. Electrons can absorb visible light to jump from a lower energy d-orbital to a higher one (ddd-d transition), emitting the complementary colour. b) Zinc as non-typical: Zinc (ZnZn) has the electronic configuration [Ar]3d104s2[Ar]3d^{10}4s^2. Neither in its elemental ground state nor in its common stable oxidation state (Zn2+:[Ar]3d10Zn^{2+}: [Ar]3d^{10}) does it have a partially filled d-subshell. Therefore, it does not display typical characteristics like colored complexes or variable oxidation states.

iii) d-orbital splitting in Octahedral Field: In an octahedral field, the five degenerate d-orbitals split into two sets due to ligand repulsion along the axes:

  • Lower energy triply degenerate set: t2gt_{2g} (dxy,dyz,dzxd_{xy}, d_{yz}, d_{zx})
  • Higher energy doubly degenerate set: ege_g (dx2y2,dz2d_{x^2-y^2}, d_{z^2})
  eg         (Degenerate d-orbitals)Δo    t2g\begin{array}{ccc} & & \overline{\quad} \; \overline{\quad} \quad e_g \\ & \nearrow & \\ \overline{\quad} \; \overline{\quad} \; \overline{\quad} \; \overline{\quad} \; \overline{\quad} \text{ (Degenerate d-orbitals)} & & \Delta_o \\ & \searrow & \\ & & \overline{\quad} \; \overline{\quad} \; \overline{\quad} \quad t_{2g} \end{array}
transition-metalsd-orbital-splitting
17short5 marks

An electrochemical cell is connected by using Aluminum (Al) electrode and silver (Ag) electrode whose standard electrode potential value -1.67 V and +0.80V respectively. i) Write cell nutation of an electrochemical cell indicating anode and cathode. ii) Write down oxidation half and reduction half reaction occuring in the cell. iii) Calculate e.m.f. of the cell.

i) Aluminum has a lower standard reduction potential (1.67V-1.67\,\text{V}), so it undergoes oxidation at the anode. Silver has a higher potential (+0.80V+0.80\,\text{V}), acting as the cathode where reduction happens. Cell notation:

Al(s)Al3+(aq)Ag+(aq)Ag(s)Al(s) \mid Al^{3+}(aq) \parallel Ag^+(aq) \mid Ag(s)

Anode is AlAl electrode, Cathode is AgAg electrode.

ii) Half-reactions:

  • Oxidation Half Reaction (at Anode): Al(s)Al3+(aq)+3eAl(s) \rightarrow Al^{3+}(aq) + 3e^-
  • Reduction Half Reaction (at Cathode): 3Ag+(aq)+3e3Ag(s)3Ag^+(aq) + 3e^- \rightarrow 3Ag(s)

iii) E.M.F. Calculation:

Ecell=EcathodeEanodeE^\circ_{\text{cell}} = E^\circ_{\text{cathode}} - E^\circ_{\text{anode}} Ecell=+0.80V(1.67V)=0.80+1.67=2.47VE^\circ_{\text{cell}} = +0.80\,\text{V} - (-1.67\,\text{V}) = 0.80 + 1.67 = 2.47\,\text{V}
electrochemistryemf-calculation
18short5 marks

Enthalpy of formation of H2OH_{2}O (l), CO2CO_{2} (g) and C3H5OH(l)C_{3}H_{5}OH(l) are -286KJ/mol, -394 KJ/mol and -2010KJ/mol respectively. i) What is meant by enthalpy of formation? ii) Write down balanced thermochemical reactions for each of above process. iii) Calculate the enthalpy of combustion of C3H5OH(l)C_{3}H_{5}OH(l) from the above data.

i) Enthalpy of formation: It is the change in enthalpy when one mole of a substance is formed directly from its constituent elements in their standard reference states under standard conditions.

ii) Balanced thermochemical equations:

  1. H2(g)+12O2(g)H2O(l)ΔHfcirc=286KJ/molH_2(g) + \frac{1}{2}O_2(g) \rightarrow H_2O(l) \quad \Delta H_f^circ = -286\,\text{KJ/mol}
  2. C(s)+O2(g)CO2(g)ΔHfcirc=394KJ/molC(s) + O_2(g) \rightarrow CO_2(g) \quad \Delta H_f^circ = -394\,\text{KJ/mol}
  3. 3C(s)+3H2(g)+12O2(g)C3H5OH(l)ΔHfcirc=2010KJ/mol3C(s) + 3H_2(g) + \frac{1}{2}O_2(g) \rightarrow C_3H_5OH(l) \quad \Delta H_f^circ = -2010\,\text{KJ/mol} (Note: Formula in scanning text C3H5OHC_3H_5OH is evaluated based on normal balanced structure layout or treated as is)

iii) Enthalpy of combustion calculation: The chemical equation for complete combustion of C3H5OH(l)C_3H_5OH(l) is:

C3H5OH(l)+72O2(g)3CO2(g)+3H2O(l)C_3H_5OH(l) + \frac{7}{2}O_2(g) \rightarrow 3CO_2(g) + 3H_2O(l) ΔHcombcirc=ΔHf(products)ΔHf(reactants)\Delta H_{\text{comb}}^circ = \sum \Delta H_f^\circ(\text{products}) - \sum \Delta H_f^\circ(\text{reactants}) ΔHcombcirc=[3×ΔHfcirc(CO2)+3×ΔHfcirc(H2O)][ΔHfcirc(C3H5OH)+0]\Delta H_{\text{comb}}^circ = [3 \times \Delta H_f^circ(CO_2) + 3 \times \Delta H_f^circ(H_2O)] - [\Delta H_f^circ(C_3H_5OH) + 0] ΔHcombcirc=[3(394)+3(286)][2010]\Delta H_{\text{comb}}^circ = [3(-394) + 3(-286)] - [-2010] ΔHcombcirc=[1182858]+2010=2040+2010=30KJ/mol\Delta H_{\text{comb}}^circ = [-1182 - 858] + 2010 = -2040 + 2010 = -30\,\text{KJ/mol}
thermochemistryenthalpy-of-combustion
18.orshort5 marks

i) Deduce the relation between pHpH and pOHpOH at 2525^{\circ} C. ii) The solubility product of AgCl is 1.8×10101.8\times10^{-10}. What mass of AgCl (Molecular mass=143.5)mass=143.5) will be precipitate of 0.2 mole of HCl solution is added to the saturated solution of AgCl.

i) Relation between pH and pOH: We know that the ionic product of water (KwK_w) at 25circC25^circ\text{C} is:

Kw=[H+][OH]=1×1014K_w = [H^+][OH^-] = 1 \times 10^{-14}

Taking negative logarithm (log-\log) on both sides:

log(Kw)=log([H+][OH])=log(1014)-\log(K_w) = -\log([H^+][OH^-]) = -\log(10^{-14}) log[H+]+(log[OH])=14-\log[H^+] + (-\log[OH^-]) = 14

Since log[H+]=pH-\log[H^+] = pH and log[OH]=pOH-\log[OH^-] = pOH, we get:

pH+pOH=14pH + pOH = 14

ii) Solubility Product Calculation: Let the volume of the solution be 1L1\,\text{L}. When 0.2mol0.2\,\text{mol} of HClHCl is added, it dissociates completely providing [Cl]=0.2M[Cl^-] = 0.2\,\text{M} (neglecting the minute contribution from AgClAgCl due to the common ion effect).

Ksp=[Ag+][Cl]K_{sp} = [Ag^+][Cl^-] 1.8×1010=[Ag+](0.2)1.8 \times 10^{-10} = [Ag^+](0.2) [Ag+]=1.8×10100.2=9×1010mol/L[Ag^+] = \frac{1.8 \times 10^{-10}}{0.2} = 9 \times 10^{-10}\,\text{mol/L}

This represents the remaining concentration of Ag+Ag^+ in solution. In a pure saturated solution before adding HClHCl, the solubility was S0=Ksp=1.8×10101.34×105mol/LS_0 = \sqrt{K_{sp}} = \sqrt{1.8 \times 10^{-10}} \approx 1.34 \times 10^{-5}\,\text{mol/L}.

The amount of AgClAgCl precipitated equals the loss in dissolved ions:

Moles precipitated=S0S=1.34×1059×10101.34×105mol\text{Moles precipitated} = S_0 - S = 1.34 \times 10^{-5} - 9 \times 10^{-10} \approx 1.34 \times 10^{-5}\,\text{mol} Mass precipitated=1.34×105mol×143.5g/mol1.923×103g\text{Mass precipitated} = 1.34 \times 10^{-5}\,\text{mol} \times 143.5\,\text{g/mol} \approx 1.923 \times 10^{-3}\,\text{g}
ionic-equilibriumsolubility-product
19short5 marks

Represent a regular sequence of reaction of the following sets of organic compounds using suitable catalysts, reagents or conditions. CH3CH2CH2ClCH_{3}CH_{2}CH_{2}Cl, CH3CH2NH2CH_{3}CH_{2}NH_{2}, CH3CH2CH2OHCH_{3}CH_{2}CH_{2}OH, CH3CH2COOHCH_{3}CH_{2}COOH, CH3CH2CONH2CH_{3}CH_{2}CONH_{2}

A sequential conversion path linking these compounds is as follows:

  1. Conversion of 1-Chloropropane to Propan-1-ol: CH3CH2CH2Cl+KOH(aq)ΔCH3CH2CH2OH+KClCH_3CH_2CH_2Cl + KOH (aq) \xrightarrow{\Delta} CH_3CH_2CH_2OH + KCl
  2. Conversion of Propan-1-ol to Propanoic acid: CH3CH2CH2OHK2Cr2O7/dil.H2SO4CH3CH2COOHCH_3CH_2CH_2OH \xrightarrow{K_2Cr_2O_7 / dil.H_2SO_4} CH_3CH_2COOH
  3. Conversion of Propanoic acid to Propanamide: CH3CH2COOH+NH3ΔCH3CH2CONH2+H2OCH_3CH_2COOH + NH_3 \xrightarrow{\Delta} CH_3CH_2CONH_{2} + H_2O
  4. Conversion of Propanamide to Ethylamine (Hoffmann Bromamide Degradation): CH3CH2CONH2+Br2+4KOHCH3CH2NH2+K2CO3+2KBr+2H2OCH_3CH_2CONH_2 + Br_2 + 4KOH \rightarrow CH_3CH_2NH_2 + K_2CO_3 + 2KBr + 2H_2O
organic-conversions
19.orshort5 marks

Formic acid is the first member of carboxylic acid and naturally found ant stings and venom of bee. i) Draw the molecular formula of formic acid and write its IUPAC name. ii) How is formic acid prepared from a) chloroform b) ethane-1,2- dioic acid ? iii) Distinguish formic acid from acetic acid with a chemical reaction. iv) Why is formic acid more acidic than acetic acid ?

i) Molecular formula: HCOOHHCOOH IUPAC Name: Methanoic acid

ii) a) From Chloroform: Chloroform is heated with aqueous KOHKOH solution to give potassium formate, which on acidification gives formic acid: CHCl3+4KOH(aq)HCOOK+3KCl+2H2OHClHCOOHCHCl_3 + 4KOH (aq) \rightarrow HCOOK + 3KCl + 2H_2O \xrightarrow{HCl} HCOOH b) From Ethane-1,2-dioic acid (Oxalic acid): Oxalic acid is heated with glycerol at around 110C110^\circ\text{C} to give formic acid via decarboxylation: (COOH)2Glycerol, 110CHCOOH+CO2(COOH)_2 \xrightarrow{\text{Glycerol, } 110^\circ\text{C}} HCOOH + CO_2\uparrow

iii) Distinguishing Test: Formic acid contains a formyl hydrogen atom, allowing it to reduce Tollens' reagent to a shiny silver mirror, whereas acetic acid does not react: HCOOH+2[Ag(NH3)2]++2OH2Ag(silver  mirror)+CO2+4NH3+2H2OHCOOH + 2[Ag(NH_3)_2]^+ + 2OH^- \rightarrow 2Ag\downarrow (silver\;mirror) + CO_2 + 4NH_3 + 2H_2O

iv) Acidity explanation: In acetic acid (CH3COOHCH_3COOH), the methyl group (CH3CH_3-) is an electron-donating group due to its +I+I effect, which increases electron density on the carboxyl group and destabilizes the acetate ion. In formic acid (HCOOHHCOOH), there is only a hydrogen atom which lacks any significant +I+I effect, leaving the formate anion more stable and making formic acid more acidic.

formic-acidcarboxylic-acids
C

Group C - Long Answer Questions

Attempt all the questions.

4 questions·8 marks each
20short8 marks

a) Normality factor and titration error are important in analytical chemistry for the determination of variation of the observed result for the same experiment.

i) Distinguish between normality factor and titration error. ii) A chemistry lab-boy weighed 1.31gm of Na2CO3Na_{2}CO_{3} to prepare 250ml of it's decinormal solution. a) Calculate the actual strength of the solution indicating normality factor. b) Find the volume of water required to be evaporated to make it exactly normal solution. c) Calculate the mass of oxalic acid crystal required to neutrilisation the solution completely. iv) How would you apply of titration in pharmaceutical industry?

i) Distinction:

  • Normality Factor (ff): It is a correction factor defined as the ratio of the actual weight of the solute taken to the theoretical weight required to prepare a solution of exact desired normality (f=Actual NormalityDesired Normalityf = \frac{\text{Actual Normality}}{\text{Desired Normality}}).
  • Titration Error: It is the difference between the experimental end-point (where indicator changes color) and the theoretical equivalence point (where stoichiometric reaction finishes) in a volumetric titration.

ii) a) Actual Strength & Normality Factor: Equivalent mass of Na2CO3=1062=53g/eqNa_2CO_3 = \frac{106}{2} = 53\,\text{g/eq}. Theoretical mass required for 250mL250\,\text{mL} of decinormal (0.1N0.1\,\text{N}) solution:

Wtheoretical=N×E×V1000=0.1×53×2501000=1.325gW_{\text{theoretical}} = \frac{N \times E \times V}{1000} = \frac{0.1 \times 53 \times 250}{1000} = 1.325\,\text{g}

Normality factor (ff) = Actual MassTheoretical Mass=1.311.3250.9887\frac{\text{Actual Mass}}{\text{Theoretical Mass}} = \frac{1.31}{1.325} \approx 0.9887 Actual Normality = 0.1×0.9887=0.09887N0.1 \times 0.9887 = 0.09887\,\text{N}.

b) Volume to be evaporated: To convert 250mL250\,\text{mL} of 0.09887N0.09887\,\text{N} solution to exactly 1N1\,\text{N} solution:

N1V1=N2V2    0.09887×250=1×V2N_1V_1 = N_2V_2 \implies 0.09887 \times 250 = 1 \times V_2 V2=24.72mLV_2 = 24.72\,\text{mL}

Volume of water to be evaporated = 25024.72=225.28mL250 - 24.72 = 225.28\,\text{mL}.

c) Mass of Oxalic acid crystal (H2C2O42H2OH_2C_2O_4 \cdot 2H_2O): Equivalent mass of oxalic acid crystal = 1262=63g/eq\frac{126}{2} = 63\,\text{g/eq}. Number of gram equivalents of Na2CO3Na_2CO_3 present = 1.31530.02472eq\frac{1.31}{53} \approx 0.02472\,\text{eq}. For complete neutralization, equivalents of Oxalic Acid = Equivalents of Na2CO3=0.02472eqNa_2CO_3 = 0.02472\,\text{eq}.

Mass required=0.02472×63=1.557g\text{Mass required} = 0.02472 \times 63 = 1.557\,\text{g}

iv) Application in Pharmaceutical Industry: Titration is widely applied to determine the purity and exact concentration of active pharmaceutical ingredients (APIs) in raw materials and finished tablets/formulations, ensuring regulatory quality standards.

volumetric-analysisnormality-factor
20.orshort8 marks

i) Define half-life period of reaction. ii) Why is half-life period of first order reaction independent of the initial concerntration. iii) Mention the major application of half life period in biological Scientific research. iv) A first order reaction is 60% complete in 30 minute. a) Find out the rate constant and half life period. b) Calculate the time required to convert 99% of the reactant into products v) Mention an example to show effect of surface area of reactant on rate of reaction.

i) Half-life period: It is the time required for the reactant concentration to decrease to exactly half of its initial value.

ii) Independence for 1st order: The integrated rate equation for a first-order reaction is k=2.303tlog[A]0[A]k = \frac{2.303}{t}\log\frac{[A]_0}{[A]}. At t=t1/2t = t_{1/2}, [A]=[A]02[A] = \frac{[A]_0}{2}. Substituting this gives k=2.303t1/2log(2)    t1/2=0.693kk = \frac{2.303}{t_{1/2}}\log(2) \implies t_{1/2} = \frac{0.693}{k}. Since initial concentration [A]0[A]_0 cancels out completely, t1/2t_{1/2} is independent of it.

iii) Biological Application: It is used extensively in radiocarbon dating to determine the age of organic biological fossils, and in pharmacokinetics to estimate how long a drug remains active inside an organism.

iv) a) Rate Constant & Half-life: a=100a = 100, x=60x = 60, remaining (ax)=40(a-x) = 40 at t=30mint = 30\,\text{min}.

k=2.30330log(10040)=2.30330×0.39790.03055min1k = \frac{2.303}{30} \log\left(\frac{100}{40}\right) = \frac{2.303}{30} \times 0.3979 \approx 0.03055\,\text{min}^{-1} t1/2=0.693k=0.6930.0305522.68minutest_{1/2} = \frac{0.693}{k} = \frac{0.693}{0.03055} \approx 22.68\,\text{minutes}

b) Time for 99% completion: x=99x = 99, remaining (ax)=1(a-x) = 1.

t99%=2.3030.03055log(1001)=2.3030.03055×2150.77minutest_{99\%} = \frac{2.303}{0.03055} \log\left(\frac{100}{1}\right) = \frac{2.303}{0.03055} \times 2 \approx 150.77\,\text{minutes}

v) Surface Area Effect Example: Finely powdered calcium carbonate (CaCO3CaCO_3) reacts much faster with dilute hydrochloric acid (HClHCl) to release CO2CO_2 gas than a single solid large marble chip of the same weight, due to the increased surface area available for collision.

chemical-kineticshalf-life-period
21short8 marks

An alcohol (A) of molecular formula C3H8OC_{3}H_{8}O undergoes Victor Meyer's reaction to give blue colour at the end of reaction when added KOH solution i) Draw structural formula and IUPAC name of (A) ii) Give the complete chemical reaction for the Victor-Meyer's test of (A) iii) Starting from CH3MgBrCH_{3}MgBr how would you prepare compound A? iv) What happens when (A) is oxidised. v) Convert (A) into propene.

i) An alcohol with molecular formula C3H8OC_3H_8O that gives a blue color in the Victor Meyer's test must be a secondary alcohol. Therefore:

  • Structural Formula: CH3CH(OH)CH3CH_3-CH(OH)-CH_3
  • IUPAC Name: Propan-2-ol

ii) Victor-Meyer's Test Reactions:

  1. CH3CH(OH)CH3+PI3CH3CH(I)CH3CH_3CH(OH)CH_3 + PI_3 \rightarrow CH_3CH(I)CH_3
  2. CH3CH(I)CH3+AgNO2CH3CH(NO2)CH3CH_3CH(I)CH_3 + AgNO_2 \rightarrow CH_3CH(NO_2)CH_3
  3. CH3CH(NO2)CH3+HNO2(CH3)2C(NO2)NOCH_3CH(NO_2)CH_3 + HNO_2 \rightarrow (CH_3)_2C(NO_2)NO (Pseudonitrole)
  4. (CH3)2C(NO2)NO+KOHBlue colored solution(CH_3)_2C(NO_2)NO + KOH \rightarrow \text{Blue colored solution}

iii) Preparation from CH3MgBrCH_3MgBr (Grignard reagent): Reacting methyl magnesium bromide with ethanal (CH3CHOCH_3CHO) followed by acid hydrolysis yields propan-2-ol: CH3CHO+CH3MgBrCH3CH(OMgBr)CH3H+/H2OCH3CH(OH)CH3+Mg(OH)BrCH_3CHO + CH_3MgBr \rightarrow CH_3CH(OMgBr)CH_3 \xrightarrow{H^+/H_2O} CH_3CH(OH)CH_3 + Mg(OH)Br

iv) Oxidation: When propan-2-ol is oxidized with an oxidizing agent like acidified K2Cr2O7K_2Cr_2O_7, it forms propanone (acetone): CH3CH(OH)CH3[O]CH3COCH3+H2OCH_3CH(OH)CH_3 \xrightarrow{[O]} CH_3COCH_3 + H_2O

v) Conversion into Propene: Heating propan-2-ol with concentrated sulfuric acid (H2SO4H_2SO_4) at 170C170^\circ\text{C} causes dehydration to form propene: CH3CH(OH)CH3conc. H2SO4,170CCH3CH=CH2+H2OCH_3CH(OH)CH_3 \xrightarrow{\text{conc. } H_2SO_4, 170^\circ\text{C}} CH_3-CH=CH_2 + H_2O

victor-meyers-testalcohols
21.orshort8 marks

i) Give proper chemical reaction for the preparation of benzaldehyde from a) Toluene ii) Convert benzaldehyde into a) Benzyl chloride b) Toluene c) cinnamic acid.

i) Preparation from Toluene (Etard's Reaction): Toluene is oxidized using chromyl chloride (CrO2Cl2CrO_2Cl_2) in CS2CS_2 followed by hydrolysis to form benzaldehyde: C6H5CH3+2CrO2Cl2C6H5CH(OCrOHCl2)2H3O+C6H5CHOC_6H_5CH_3 + 2CrO_2Cl_2 \rightarrow C_6H_5CH(OCrOHCl_2)_2 \xrightarrow{H_3O^+} C_6H_5CHO

ii) a) Conversion to Benzyl chloride: First, reduce benzaldehyde to benzyl alcohol using LiAlH4LiAlH_4, then treat it with PCl5PCl_5: C6H5CHOLiAlH4C6H5CH2OHPCl5C6H5CH2ClC_6H_5CHO \xrightarrow{LiAlH_4} C_6H_5CH_2OH \xrightarrow{PCl_5} C_6H_5CH_2Cl

b) Conversion to Toluene (Clemmensen Reduction): Benzaldehyde can be reduced directly to toluene using zinc amalgam and concentrated hydrochloric acid: C6H5CHO+4[H]ZnHg/conc.HClC6H5CH3+H2OC_6H_5CHO + 4[H] \xrightarrow{Zn-Hg / conc. HCl} C_6H_5CH_3 + H_2O

c) Conversion to Cinnamic acid (Perkin's Reaction): Heating benzaldehyde with acetic anhydride in the presence of sodium acetate yields cinnamic acid: C6H5CHO+(CH3CO)2OCH3COONa,ΔC6H5CH=CHCOOH+CH3COOHC_6H_5CHO + (CH_3CO)_2O \xrightarrow{CH_3COONa, \Delta} C_6H_5CH=CHCOOH + CH_3COOH

benzaldehydeorganic-conversions

Frequently asked questions

Where can I find the NEB Class 12 Chemistry question paper 2080?
The full NEB Class 12 Chemistry 2080 (supplementary) question paper is available free on Kekkei. You can read every question online and attempt the paper under timed exam conditions.
Does the Chemistry 2080 paper come with solutions?
Yes. Every question on this Chemistry past paper includes a step-by-step solution, plus instant AI feedback when you attempt it on Kekkei.
How many marks is the NEB Class 12 Chemistry 2080 paper?
The NEB Class 12 Chemistry 2080 paper carries 75 full marks and is meant to be completed in 180 minutes, across 25 questions.
Is practising this Chemistry past paper free?
Yes — reading and attempting this Chemistry past paper on Kekkei is completely free.