Browse papers
LevelNEB Class 12
StreamScience
SubjectMathematics
Year2082 BS
Exam sessionRegular (annual)
Full marks75
Time allowed180 minutes
Questions29, all with step-by-step solutions
A

Group 'A'

Rewrite the correct option of each question in your answer sheet.

11 questions·1 mark each
1Multiple choice1 mark

Let z1=cosθ1+isinθ1z_1 = \cos\theta_1 + i\sin\theta_1 and z2=cosθ2+isinθ2z_2 = \cos\theta_2 + i\sin\theta_2 are two complex numbers, then

  • A

    z1z2=cos(θ1+θ2)+isin(θ1+θ2)\frac{z_1}{z_2} = \cos(\theta_1 + \theta_2) + i\sin(\theta_1 + \theta_2)

  • B

    z1z2=cos(θ1θ2)+isin(θ1θ2)\frac{z_1}{z_2} = \cos(\theta_1 - \theta_2) + i\sin(\theta_1 - \theta_2)

  • C

    z1z2=cos(θ1+θ2)isin(θ1+θ2)\frac{z_1}{z_2} = \cos(\theta_1 + \theta_2) - i\sin(\theta_1 + \theta_2)

  • D

    z1z2=cos(θ1θ2)isin(θ1θ2)\frac{z_1}{z_2} = \cos(\theta_1 - \theta_2) - i\sin(\theta_1 - \theta_2)

Correct answer: B

z1z2=cos(θ1θ2)+isin(θ1θ2)\frac{z_1}{z_2} = \cos(\theta_1 - \theta_2) + i\sin(\theta_1 - \theta_2)

Using De Moivre / Euler form, z1z2=cosθ1+isinθ1cosθ2+isinθ2=cos(θ1θ2)+isin(θ1θ2)\frac{z_1}{z_2} = \frac{\cos\theta_1 + i\sin\theta_1}{\cos\theta_2 + i\sin\theta_2} = \cos(\theta_1 - \theta_2) + i\sin(\theta_1 - \theta_2). So option B is correct.

complex-numbers
2Multiple choice1 mark

The nature of the roots of the equation x2x+1=0x^2 - x + 1 = 0 are.

  • A

    Real and equal

  • B

    Rational and unequal

  • C

    Irrational and unequal

  • D

    Imaginary

Correct answer: D

Imaginary

Discriminant D=b24ac=(1)24(1)(1)=14=3<0D = b^2 - 4ac = (-1)^2 - 4(1)(1) = 1 - 4 = -3 < 0. Since D<0D < 0, the roots are imaginary (complex). So option D is correct.

quadratic-equations
3Multiple choice1 mark

The equation sinx+cosx=2\sin x + \cos x = 2 has

  • A

    unique solution

  • B

    no solution

  • C

    finite solution

  • D

    infinite solutions

Correct answer: B

no solution

The maximum value of sinx+cosx\sin x + \cos x is 21.414<2\sqrt{2} \approx 1.414 < 2. Hence the equation can never be satisfied, so it has no solution. Option B is correct.

trigonometric-equations
4Multiple choice1 mark

The value of sin(2cos112)\sin\left(2\cos^{-1}\frac{1}{2}\right) is equal to

  • A

    32\frac{\sqrt{3}}{2}

  • B

    11

  • C

    12\frac{1}{2}

  • D

    1-1

Correct answer: A

32\frac{\sqrt{3}}{2}

Let cos112=θ\cos^{-1}\frac{1}{2} = \theta, so θ=π3\theta = \frac{\pi}{3}. Then sin(2θ)=sin2π3=32\sin(2\theta) = \sin\frac{2\pi}{3} = \frac{\sqrt{3}}{2}. Option A is correct.

inverse-trigonometric-functions
5Multiple choice1 mark

What is a×b\vec{a} \times \vec{b} if a=(0,2,0)\vec{a} = (0, 2, 0) and b=(0,0,2)\vec{b} = (0, 0, 2) ?

  • A

    (4,0,0)(4, 0, 0)

  • B

    (0,4,0)(0, 4, 0)

  • C

    (0,0,4)(0, 0, 4)

  • D

    (4,0,0)(-4, 0, 0)

Correct answer: A

(4,0,0)(4, 0, 0)

a×b=ijk020002=i(2200)j(0200)+k(0020)=(4,0,0)\vec{a} \times \vec{b} = \begin{vmatrix} \vec{i} & \vec{j} & \vec{k} \\ 0 & 2 & 0 \\ 0 & 0 & 2 \end{vmatrix} = \vec{i}(2\cdot2 - 0\cdot0) - \vec{j}(0\cdot2 - 0\cdot0) + \vec{k}(0\cdot0 - 2\cdot0) = (4, 0, 0). Option A is correct.

vectorscross-product
6Multiple choice1 mark

What is the foci of the hyperbola x2a2y2b2=1\frac{x^2}{a^2} - \frac{y^2}{b^2} = -1 ?

  • A

    (0,±b)(0, \pm b)

  • B

    (0,±be)(0, \pm be)

  • C

    (0,±ae)(0, \pm ae)

  • D

    (±be,0)(\pm be, 0)

Correct answer: B

(0,±be)(0, \pm be)

The equation x2a2y2b2=1\frac{x^2}{a^2} - \frac{y^2}{b^2} = -1 (i.e. y2b2x2a2=1\frac{y^2}{b^2} - \frac{x^2}{a^2} = 1) is a hyperbola with transverse axis along the yy-axis. Its foci are at (0,±be)(0, \pm be), where ee is the eccentricity. Option B is correct.

conic-sectionshyperbola
7Multiple choice1 mark

A fair coin is tossed ten times. What is the mean of the binomial distribution ?

  • A

    2.52.5

  • B

    55

  • C

    1010

  • D

    2020

Correct answer: B

55

For a binomial distribution, mean =np=10×12=5= np = 10 \times \frac{1}{2} = 5. Option B is correct.

probabilitybinomial-distribution
8Multiple choice1 mark

The first order derivative of f(x)=2x2f(x) = 2x^2 at x=1x = 1 ...

  • A

    18\frac{1}{8}

  • B

    14\frac{1}{4}

  • C

    44

  • D

    88

Correct answer: C

44

f(x)=4xf'(x) = 4x, so f(1)=4f'(1) = 4. Option C is correct.

derivativesdifferentiation
9Multiple choice1 mark

The order of the differential equation (d2ydx2)3+(dydx)2+x+4=0\left(\frac{d^2y}{dx^2}\right)^3 + \left(\frac{dy}{dx}\right)^2 + x + 4 = 0 is

  • A

    11

  • B

    22

  • C

    33

  • D

    44

Correct answer: B

22

The order is the order of the highest derivative present, which is d2ydx2\frac{d^2y}{dx^2} (second derivative). So the order is 22. Option B is correct.

differential-equations
10Multiple choice1 mark

Solving a system of equations by Gauss eliminations method, a student obtained the following three equations x1+x3x2=1x_1 + x_3 - x_2 = 1, x3x2=1x_3 - x_2 = 1, 0.x2=50.x_2 = -5. What relation can be drawn from above about the the system of given equations ?

  • A

    Only one solution

  • B

    Two solution

  • C

    No solution

  • D

    Infinite solution

Correct answer: C

No solution

The last equation 0x2=50 \cdot x_2 = -5 is impossible (it states 0=50 = -5), which is a contradiction. Hence the system is inconsistent and has no solution. Option C is correct.

system-of-equationsgauss-elimination
11Multiple choice1 mark

If two like parallel forces of 5N and 15N act on the light rod at two points P and Q respectively 6m apart. The distance of resultant from the point Q is...

Or

The supply and demand function for particular items are given by Ps=160+2Q2P_s = 160 + 2Q^2 and Pd=2403Q2P_d = 240 - 3Q^2 then the equilibrium quantity is

  • A

    1 m / 2

  • B

    1.5 m / 4

  • C

    2.5 m / 8

  • D

    4.5 m / 16

Correct answer: B

1.5 m / 4

For the statics part: For like parallel forces, the resultant divides the line internally in the inverse ratio of the forces. If xx is the distance of the resultant from Q, then 5×(6x)=15×x5 \times (6 - x) = 15 \times x (taking moments about the line of the resultant), giving 305x=15x30 - 5x = 15x, so 20x=3020x = 30, x=1.5x = 1.5 m from Q. Option B (1.5 m) is correct.

For the OR (economics) part: At equilibrium Ps=PdP_s = P_d, so 160+2Q2=2403Q25Q2=80Q2=16Q=4160 + 2Q^2 = 240 - 3Q^2 \Rightarrow 5Q^2 = 80 \Rightarrow Q^2 = 16 \Rightarrow Q = 4. Option B (4) is correct for the OR alternative.

staticsparallel-forces
B

Group 'B'

11 questions·5 marks each
12Short answer5 marks

For binomial expansion of (1+x)n(1 + x)^n

a) Write it in expanded form. [1]

b) Write down its first four coefficients. [1]

c) What is the sum of all binomial coefficient when x=1x = 1 ? [1]

d) If nn is even, write the middle term. [1]

e) If C(n,r1)=C(n,r2)C(n, r_1) = C(n, r_2), then write down the relation of r1r_1, r2r_2 and nn. [1]

a) (1+x)n=(n0)+(n1)x+(n2)x2+(n3)x3++(nn)xn(1 + x)^n = \binom{n}{0} + \binom{n}{1}x + \binom{n}{2}x^2 + \binom{n}{3}x^3 + \cdots + \binom{n}{n}x^n.

b) First four coefficients: (n0)=1\binom{n}{0} = 1, (n1)=n\binom{n}{1} = n, (n2)=n(n1)2!\binom{n}{2} = \frac{n(n-1)}{2!}, (n3)=n(n1)(n2)3!\binom{n}{3} = \frac{n(n-1)(n-2)}{3!}.

c) Putting x=1x = 1: (1+1)n=2n=r=0n(nr)(1+1)^n = 2^n = \sum_{r=0}^{n}\binom{n}{r}. So the sum of all binomial coefficients is 2n2^n.

d) When nn is even, there is a single middle term, the (n2+1)\left(\frac{n}{2} + 1\right)th term: Tn2+1=(nn/2)xn/2T_{\frac{n}{2}+1} = \binom{n}{n/2}x^{n/2}.

e) C(n,r1)=C(n,r2)C(n, r_1) = C(n, r_2) holds when either r1=r2r_1 = r_2 or r1+r2=nr_1 + r_2 = n.

binomial-theorem
13Short answer5 marks

Prove by mathematical induction, 12+22+32++n2=n(n+1)(2n+1)61^2 + 2^2 + 3^2 + \cdots + n^2 = \frac{n(n+1)(2n+1)}{6}, for every natural number nn. [5]

Let P(n):12+22++n2=n(n+1)(2n+1)6P(n): 1^2 + 2^2 + \cdots + n^2 = \frac{n(n+1)(2n+1)}{6}.

Base step: For n=1n = 1, LHS =12=1= 1^2 = 1, RHS =1236=1= \frac{1\cdot2\cdot3}{6} = 1. So P(1)P(1) is true.

Inductive step: Assume P(k)P(k) is true: 12+22++k2=k(k+1)(2k+1)61^2 + 2^2 + \cdots + k^2 = \frac{k(k+1)(2k+1)}{6}.

Then for n=k+1n = k+1:

12+22++k2+(k+1)2=k(k+1)(2k+1)6+(k+1)21^2 + 2^2 + \cdots + k^2 + (k+1)^2 = \frac{k(k+1)(2k+1)}{6} + (k+1)^2 =(k+1)[k(2k+1)+6(k+1)]6=(k+1)(2k2+7k+6)6= \frac{(k+1)\left[k(2k+1) + 6(k+1)\right]}{6} = \frac{(k+1)(2k^2 + 7k + 6)}{6} =(k+1)(k+2)(2k+3)6=(k+1)((k+1)+1)(2(k+1)+1)6.= \frac{(k+1)(k+2)(2k+3)}{6} = \frac{(k+1)\big((k+1)+1\big)\big(2(k+1)+1\big)}{6}.

Thus P(k+1)P(k+1) is true whenever P(k)P(k) is true. By the principle of mathematical induction, P(n)P(n) holds for every natural number nn.

mathematical-induction
14aShort answer3 marks

If tan1x+tan1y+tan1z=π2\tan^{-1}x + \tan^{-1}y + \tan^{-1}z = \frac{\pi}{2}, prove that xy+yz+zx=1xy + yz + zx = 1. [3]

Given tan1x+tan1y+tan1z=π2\tan^{-1}x + \tan^{-1}y + \tan^{-1}z = \frac{\pi}{2}.

So tan1x+tan1y=π2tan1z\tan^{-1}x + \tan^{-1}y = \frac{\pi}{2} - \tan^{-1}z.

Taking tangent of both sides and using tan1x+tan1y=tan1x+y1xy\tan^{-1}x + \tan^{-1}y = \tan^{-1}\frac{x+y}{1-xy}:

x+y1xy=tan(π2tan1z)=cot(tan1z)=1z.\frac{x+y}{1-xy} = \tan\left(\frac{\pi}{2} - \tan^{-1}z\right) = \cot(\tan^{-1}z) = \frac{1}{z}.

Thus z(x+y)=1xyz(x+y) = 1 - xy, i.e. zx+zy=1xyzx + zy = 1 - xy, giving xy+yz+zx=1xy + yz + zx = 1. Proved.

inverse-trigonometric-functions
14bShort answer2 marks

Find the equation of a plane passing through (3,2,1)(-3, -2, -1) and parallel to the plane 2x+5y2=02x + 5y - 2 = 0. [2]

A plane parallel to 2x+5y2=02x + 5y - 2 = 0 has the form 2x+5y+d=02x + 5y + d = 0 (the zz-coefficient is 00). It passes through (3,2,1)(-3, -2, -1):

2(3)+5(2)+d=0610+d=0d=16.2(-3) + 5(-2) + d = 0 \Rightarrow -6 - 10 + d = 0 \Rightarrow d = 16.

Hence the required plane is 2x+5y+16=02x + 5y + 16 = 0.

coordinate-geometry-3dplane
15aShort answer2 marks

A factory has two machines P and Q. Machine P produces 70% of the total output and Q produces 45% of the total output. Further 10% of output of machine P and 8% output of machine Q are likely to be defective. If an output selected random is deflective, write the probability of defective separately from P and Q. [2]

Note: the stated production shares (70% and 45%) sum to 115%, which is inconsistent; the figures are taken as printed. Treating the defective contributions directly:

Probability that a selected item is from P and defective =0.70×0.10=0.07= 0.70 \times 0.10 = 0.07.

Probability that a selected item is from Q and defective =0.45×0.08=0.036= 0.45 \times 0.08 = 0.036.

So the (joint) probability of a defective item coming from P is 0.070.07 and from Q is 0.0360.036. (If a normalised conditional probability is required, total defective =0.07+0.036=0.106= 0.07 + 0.036 = 0.106, giving P(from Pdefective)=0.070.1060.660P(\text{from P} \mid \text{defective}) = \frac{0.07}{0.106} \approx 0.660 and P(from Qdefective)=0.0360.1060.340P(\text{from Q} \mid \text{defective}) = \frac{0.036}{0.106} \approx 0.340.)

probability
15bShort answer3 marks

Find the most likely price in Pokhara corresponding to Rs. 200 in Chitwan for one kilogram of orange using regression from the following data. [3]

PokharaChitwan
Average priceRs. 160Rs. 120
Standard deviation812
Correlation coefficient =0.6

(Correlation coefficient r=0.6r = 0.6 for the pair.)

Let XX = Pokhara price, YY = Chitwan price. Given Xˉ=160\bar{X} = 160, σX=8\sigma_X = 8, Yˉ=120\bar{Y} = 120, σY=12\sigma_Y = 12, r=0.6r = 0.6.

The regression line of XX on YY:

XXˉ=rσXσY(YYˉ).X - \bar{X} = r\frac{\sigma_X}{\sigma_Y}(Y - \bar{Y}).

Regression coefficient bXY=rσXσY=0.6×812=0.4b_{XY} = r\frac{\sigma_X}{\sigma_Y} = 0.6 \times \frac{8}{12} = 0.4.

For Y=200Y = 200:

X160=0.4(200120)=0.4×80=32.X - 160 = 0.4(200 - 120) = 0.4 \times 80 = 32.

So X=160+32=192X = 160 + 32 = 192. The most likely price in Pokhara is Rs. 192.

statisticsregression
16Short answer5 marks

a) Write the statement of mean value theorem. [1]

b) Write the derivate of y=coshxy = \cosh x? [1]

c) Write the integration of a2+x2dx\sqrt{a^2 + x^2}\, dx ? [1]

d) Write the geometrical interpretation of mean-value theorem. [1]

e) If f(x)f(x) and g(x)g(x) are two function with degree of f(x)<f(x) < degree of g(x)g(x), then what the types of function f(x)g(x)\frac{f(x)}{g(x)} is called ? [1]

a) (Lagrange's) Mean Value Theorem: If ff is continuous on [a,b][a, b] and differentiable on (a,b)(a, b), then there exists at least one point c(a,b)c \in (a, b) such that f(c)=f(b)f(a)baf'(c) = \frac{f(b) - f(a)}{b - a}.

b) ddx(coshx)=sinhx\frac{d}{dx}(\cosh x) = \sinh x.

c) a2+x2dx=x2a2+x2+a22lnx+a2+x2+C\int \sqrt{a^2 + x^2}\, dx = \frac{x}{2}\sqrt{a^2 + x^2} + \frac{a^2}{2}\ln\left|x + \sqrt{a^2 + x^2}\right| + C.

d) Geometrically, there is at least one point cc on the curve y=f(x)y = f(x) between aa and bb where the tangent is parallel to the chord (secant line) joining the points (a,f(a))(a, f(a)) and (b,f(b))(b, f(b)).

e) When the degree of the numerator f(x)f(x) is less than the degree of the denominator g(x)g(x), the rational function f(x)g(x)\frac{f(x)}{g(x)} is called a proper (rational) fraction.

calculusmean-value-theoremintegration
17Short answer5 marks

Solve the differential equation by reducing in linear form dydx+yxx2=0\frac{dy}{dx} + \frac{y}{x} - x^2 = 0. [5]

Rewrite as dydx+1xy=x2\frac{dy}{dx} + \frac{1}{x}y = x^2, a linear ODE with P=1xP = \frac{1}{x}, Q=x2Q = x^2.

Integrating factor: IF=e1xdx=elnx=x\text{IF} = e^{\int \frac{1}{x}dx} = e^{\ln x} = x.

Solution: yx=xx2dx+C=x3dx+C=x44+Cy \cdot x = \int x \cdot x^2\, dx + C = \int x^3\, dx + C = \frac{x^4}{4} + C.

Hence xy=x44+Cxy = \frac{x^4}{4} + C, i.e. y=x34+Cxy = \frac{x^3}{4} + \frac{C}{x}.

differential-equationslinear-ode
18Short answer5 marks

Using Simplex method, maximize P(x,y)=50x+60yP(x, y) = 50x + 60y, subject to constraints 3x+4y363x + 4y \le 36, 9x+4y609x + 4y \le 60, x,y0x, y \ge 0. [5]

Maximize P=50x+60yP = 50x + 60y subject to 3x+4y363x + 4y \le 36, 9x+4y609x + 4y \le 60, x,y0x, y \ge 0.

Corner (vertex) evaluation:

  • Intersection of 3x+4y=363x + 4y = 36 and 9x+4y=609x + 4y = 60: subtracting gives 6x=24x=46x = 24 \Rightarrow x = 4, then 3(4)+4y=364y=24y=63(4) + 4y = 36 \Rightarrow 4y = 24 \Rightarrow y = 6. Point (4,6)(4, 6).
  • xx-intercepts: 9x=60x=2039x = 60 \Rightarrow x = \frac{20}{3} from second; 3x=36x=123x=36 \Rightarrow x=12 from first. The binding xx-axis vertex is (203,0)\left(\frac{20}{3}, 0\right).
  • yy-intercept: 4y=36y=94y = 36 \Rightarrow y = 9 from first; 4y=60y=154y = 60 \Rightarrow y = 15 from second. Binding yy-axis vertex is (0,9)(0, 9).

Objective values:

  • (0,0)(0, 0): P=0P = 0.
  • (203,0)\left(\frac{20}{3}, 0\right): P=50×203=10003333.3P = 50 \times \frac{20}{3} = \frac{1000}{3} \approx 333.3.
  • (4,6)(4, 6): P=50(4)+60(6)=200+360=560P = 50(4) + 60(6) = 200 + 360 = 560.
  • (0,9)(0, 9): P=60×9=540P = 60 \times 9 = 540.

Maximum P=560P = 560 at x=4x = 4, y=6y = 6.

linear-programmingsimplex-method
19aShort answer2 marks

A straight uniform rod is 3m long when a rod of 5N is placed at one end it balances about a point 25cm from the end. Find the weight of rod.

Or

a) A firm has demand function P=1085QP = 108 - 5Q and the cost function C=12Q+Q2C = -12Q + Q^2. Find the price at which the profit in maximum. [2]

Statics part: Let WW be the weight of the uniform rod (acting at its midpoint, 150 cm from each end). A weight of 5 N is placed at one end; the system balances about a pivot 25 cm from that end.

Taking moments about the pivot (25 cm from the loaded end):

  • The 5 N weight is 25 cm on one side: moment =5×25= 5 \times 25.
  • The rod's weight WW acts at its centre, 15025=125150 - 25 = 125 cm on the other side: moment =W×125= W \times 125.

Balancing: 5×25=W×125125=125WW=15 \times 25 = W \times 125 \Rightarrow 125 = 125W \Rightarrow W = 1 N.

The weight of the rod is 1 N.

OR (economics) part a: Profit π=PQC=(1085Q)Q(12Q+Q2)=108Q5Q2+12QQ2=120Q6Q2\pi = PQ - C = (108 - 5Q)Q - (-12Q + Q^2) = 108Q - 5Q^2 + 12Q - Q^2 = 120Q - 6Q^2. Then dπdQ=12012Q=0Q=10\frac{d\pi}{dQ} = 120 - 12Q = 0 \Rightarrow Q = 10, and d2πdQ2=12<0\frac{d^2\pi}{dQ^2} = -12 < 0 (maximum). Price P=1085(10)=58P = 108 - 5(10) = 58. So profit is maximum at price Rs. 58 (with Q=10Q = 10).

staticsmoments
19bShort answer3 marks

A force equal to 4.9N acting on a body changes its velocity from 3m/s to 5m/s when it covers a distance of 16m. Find the mass of body. [3]

Or

b) A person deposits Rs. 1,00,000 in the bank which pays the compound interest 10% p.a. to its customer. What will be the total value of deposit after 5 years if [3]

i) no extra deposits are made ?

ii) Rs. 20,000 is deposited at the end of each year ?

Dynamics part: Using v2=u2+2asv^2 = u^2 + 2as with u=3u = 3, v=5v = 5, s=16s = 16:

25=9+2a(16)16=32aa=0.5 m/s2.25 = 9 + 2a(16) \Rightarrow 16 = 32a \Rightarrow a = 0.5\ \text{m/s}^2.

Then F=ma4.9=m×0.5m=9.8F = ma \Rightarrow 4.9 = m \times 0.5 \Rightarrow m = 9.8 kg.

The mass of the body is 9.8 kg.

OR (economics) part b: Principal P=100000P = 100000, rate r=10%r = 10\%, n=5n = 5 years.

i) No extra deposits: A=P(1+r)n=100000(1.1)5=100000×1.61051=Rs. 161051A = P(1 + r)^n = 100000(1.1)^5 = 100000 \times 1.61051 = \text{Rs. } 161051.

ii) Initial Rs. 100000 grows to Rs. 161051 (as above). Additionally Rs. 20000 deposited at the end of each year for 5 years forms an ordinary annuity:

FV=20000×(1.1)510.1=20000×0.610510.1=20000×6.1051=Rs. 122102.\text{FV} = 20000 \times \frac{(1.1)^5 - 1}{0.1} = 20000 \times \frac{0.61051}{0.1} = 20000 \times 6.1051 = \text{Rs. } 122102.

Total value =161051+122102=Rs. 283153= 161051 + 122102 = \text{Rs. } 283153.

dynamicsnewtons-laws
C

Group 'C'

7 questions·8 marks each
20aLong answer3 marks

Rita has 16th16^{\text{th}} birthday party. She has invited 12 friends of whom 7 are relatives. In how many ways can she invite 6 guests so that 4 of them may be relatives ? [3]

She must choose 4 relatives from the 7 relatives and the remaining 64=26 - 4 = 2 guests from the 127=512 - 7 = 5 non-relatives.

Number of ways =(74)×(52)=35×10=350= \binom{7}{4} \times \binom{5}{2} = 35 \times 10 = 350.

So she can invite the guests in 350 ways.

combinationspermutations-combinations
20bLong answer2 marks

Find the sum of the first nn terms of the natural numbers using mathematical induction. [2]

Claim: 1+2+3++n=n(n+1)21 + 2 + 3 + \cdots + n = \frac{n(n+1)}{2}. Let P(n)P(n) be this statement.

Base step: For n=1n = 1, LHS =1= 1, RHS =122=1= \frac{1\cdot2}{2} = 1. True.

Inductive step: Assume P(k)P(k): 1+2++k=k(k+1)21 + 2 + \cdots + k = \frac{k(k+1)}{2}. Then

1+2++k+(k+1)=k(k+1)2+(k+1)=(k+1)(k2+1)=(k+1)(k+2)2,1 + 2 + \cdots + k + (k+1) = \frac{k(k+1)}{2} + (k+1) = (k+1)\left(\frac{k}{2} + 1\right) = \frac{(k+1)(k+2)}{2},

which is P(k+1)P(k+1). By induction, 1+2++n=n(n+1)21 + 2 + \cdots + n = \frac{n(n+1)}{2} for all natural numbers nn.

mathematical-induction
20cLong answer3 marks

Find the values of xx, yy and zz by using matrix method of the equations 2xy+z=12x - y + z = -1, x2y+3z=4x - 2y + 3z = 4 and 4x+y+2z=44x + y + 2z = 4. [3]

Write Ax=bA\mathbf{x} = \mathbf{b} with A=(211123412)A = \begin{pmatrix} 2 & -1 & 1 \\ 1 & -2 & 3 \\ 4 & 1 & 2 \end{pmatrix}, b=(144)\mathbf{b} = \begin{pmatrix} -1 \\ 4 \\ 4 \end{pmatrix}.

detA=2(2231)(1)(1234)+1(11(2)4)=2(7)+1(10)+1(9)=1410+9=15\det A = 2(-2\cdot2 - 3\cdot1) - (-1)(1\cdot2 - 3\cdot4) + 1(1\cdot1 - (-2)\cdot4) = 2(-7) + 1(-10) + 1(9) = -14 - 10 + 9 = -15.

Using Cramer's rule: detAx=111423412=1(43)+1(812)+1(4+8)=74+12=15\det A_x = \begin{vmatrix} -1 & -1 & 1 \\ 4 & -2 & 3 \\ 4 & 1 & 2 \end{vmatrix} = -1(-4-3) +1(8-12) + 1(4+8) = 7 - 4 + 12 = 15, so x=1515=1x = \frac{15}{-15} = -1.

detAy=211143442=2(812)+1(212)+1(416)=81012=30\det A_y = \begin{vmatrix} 2 & -1 & 1 \\ 1 & 4 & 3 \\ 4 & 4 & 2 \end{vmatrix} = 2(8-12) +1(2-12) + 1(4-16) = -8 -10 -12 = -30, so y=3015=2y = \frac{-30}{-15} = 2.

detAz=211124414=2(84)+1(416)1(1+8)=24129=45\det A_z = \begin{vmatrix} 2 & -1 & -1 \\ 1 & -2 & 4 \\ 4 & 1 & 4 \end{vmatrix} = 2(-8-4) +1(4-16) -1(1+8) = -24 -12 -9 = -45, so z=4515=3z = \frac{-45}{-15} = 3.

Check in eq. 1: 2(1)2+3=12(-1) - 2 + 3 = -1 ✓; eq. 2: 14+9=4-1 - 4 + 9 = 4 ✓; eq. 3: 4+2+6=4-4 + 2 + 6 = 4 ✓.

Hence x=1x = -1, y=2y = 2, z=3z = 3.

matricessystem-of-equations
21aLong answer5 marks

Find the direction cosines of two lines which satisfy the relation 2l+2mn=02l + 2m - n = 0 and lm+mn+nl=0lm + mn + nl = 0. Also find the angle between two lines. [5]

From 2l+2mn=02l + 2m - n = 0 we get n=2l+2mn = 2l + 2m. Substitute into lm+mn+nl=0lm + mn + nl = 0:

lm+(l+n)m...lm + (l + n)m...

More directly: lm+n(m+l)=0lm+(2l+2m)(l+m)=0lm + n(m + l) = 0 \Rightarrow lm + (2l + 2m)(l + m) = 0.

Expand: lm+2(l+m)2=0lm+2(l2+2lm+m2)=02l2+5lm+2m2=0lm + 2(l + m)^2 = 0 \Rightarrow lm + 2(l^2 + 2lm + m^2) = 0 \Rightarrow 2l^2 + 5lm + 2m^2 = 0.

Divide by m2m^2 and let t=l/mt = l/m: 2t2+5t+2=0t=5±25164=5±342t^2 + 5t + 2 = 0 \Rightarrow t = \frac{-5 \pm \sqrt{25 - 16}}{4} = \frac{-5 \pm 3}{4}, so t=12t = -\frac{1}{2} or t=2t = -2.

Line 1 (l:m=1:2l : m = -1 : 2): then n=2l+2m=2(1)+2(2)=2n = 2l + 2m = 2(-1) + 2(2) = 2. So (l,m,n)(1,2,2)(l, m, n) \propto (-1, 2, 2), magnitude 1+4+4=3\sqrt{1 + 4 + 4} = 3. Direction cosines (13,23,23)\left(-\frac{1}{3}, \frac{2}{3}, \frac{2}{3}\right).

Line 2 (l:m=2:1l : m = -2 : 1): then n=2(2)+2(1)=2n = 2(-2) + 2(1) = -2. So (l,m,n)(2,1,2)(l, m, n) \propto (-2, 1, -2), magnitude 33. Direction cosines (23,13,23)\left(-\frac{2}{3}, \frac{1}{3}, -\frac{2}{3}\right).

Angle: cosθ=l1l2+m1m2+n1n2=(13)(23)+2313+23(23)=29+2949=0\cos\theta = l_1 l_2 + m_1 m_2 + n_1 n_2 = \left(-\frac{1}{3}\right)\left(-\frac{2}{3}\right) + \frac{2}{3}\cdot\frac{1}{3} + \frac{2}{3}\cdot\left(-\frac{2}{3}\right) = \frac{2}{9} + \frac{2}{9} - \frac{4}{9} = 0.

Since cosθ=0\cos\theta = 0, the angle between the two lines is θ=90°\theta = 90° (the lines are perpendicular).

direction-cosinescoordinate-geometry-3d
21bLong answer3 marks

Prove by vector method sin(AB)=sinAcosBcosAsinB\sin(A - B) = \sin A\cos B - \cos A\sin B. [3]

Take unit vectors in the xyxy-plane making angles AA and BB with the positive xx-axis:

a^=cosAi^+sinAj^,b^=cosBi^+sinBj^.\hat{a} = \cos A\,\hat{i} + \sin A\,\hat{j}, \qquad \hat{b} = \cos B\,\hat{i} + \sin B\,\hat{j}.

The angle between a^\hat{a} and b^\hat{b} is (AB)(A - B). The cross product (in the zz-direction):

b^×a^=(cosBsinAsinBcosA)k^.\hat{b} \times \hat{a} = (\cos B\sin A - \sin B\cos A)\,\hat{k}.

Also b^×a^=a^b^sin(AB)=sin(AB)|\hat{b} \times \hat{a}| = |\hat{a}||\hat{b}|\sin(A - B) = \sin(A - B) (taking A>BA > B, with k^\hat{k} direction).

Equating the k^\hat{k} components:

sin(AB)=sinAcosBcosAsinB.\sin(A - B) = \sin A\cos B - \cos A\sin B.

Proved.

vectorstrigonometry
22aLong answer5 marks

State Rolle's theorem, interpret it geometrically and verify it for f(x)=x(x3)2f(x) = x(x - 3)^2 for x[0,3]x \in [0, 3]. [5]

Statement: If ff is continuous on [a,b][a, b], differentiable on (a,b)(a, b), and f(a)=f(b)f(a) = f(b), then there exists at least one c(a,b)c \in (a, b) such that f(c)=0f'(c) = 0.

Geometric interpretation: If the curve y=f(x)y = f(x) has equal ordinates at the endpoints, then there is at least one point between them where the tangent to the curve is horizontal (parallel to the xx-axis).

Verification for f(x)=x(x3)2f(x) = x(x - 3)^2 on [0,3][0, 3]:

  • ff is a polynomial, so continuous on [0,3][0, 3] and differentiable on (0,3)(0, 3).
  • f(0)=0(3)2=0f(0) = 0\cdot(−3)^2 = 0 and f(3)=302=0f(3) = 3\cdot0^2 = 0, so f(0)=f(3)f(0) = f(3).

All conditions hold. Now f(x)=x(x3)2=x(x26x+9)=x36x2+9xf(x) = x(x-3)^2 = x(x^2 - 6x + 9) = x^3 - 6x^2 + 9x, so

f(x)=3x212x+9=3(x24x+3)=3(x1)(x3).f'(x) = 3x^2 - 12x + 9 = 3(x^2 - 4x + 3) = 3(x - 1)(x - 3).

Setting f(x)=0f'(x) = 0: x=1x = 1 or x=3x = 3. The value x=1(0,3)x = 1 \in (0, 3), so c=1c = 1 satisfies Rolle's theorem. Hence Rolle's theorem is verified.

rolles-theoremcalculus
22bLong answer3 marks

Evaluate: limx5x2255+4xx2\lim_{x \to 5} \frac{x^2 - 25}{5 + 4x - x^2}, using L-Hospital's rule. [3]

At x=5x = 5: numerator =2525=0= 25 - 25 = 0 and denominator =5+2025=0= 5 + 20 - 25 = 0, a 00\frac{0}{0} form.

Applying L'Hospital's rule (differentiate numerator and denominator):

limx5x2255+4xx2=limx52x42x=2(5)42(5)=10410=106=53.\lim_{x \to 5} \frac{x^2 - 25}{5 + 4x - x^2} = \lim_{x \to 5} \frac{2x}{4 - 2x} = \frac{2(5)}{4 - 2(5)} = \frac{10}{4 - 10} = \frac{10}{-6} = -\frac{5}{3}.
limitslhospitals-rule

Frequently asked questions

Where can I find the NEB Class 12 Mathematics question paper 2082?
The full NEB Class 12 Mathematics 2082 (Regular (annual)) question paper is available free on Kekkei. You can read every question online and attempt the paper under timed exam conditions.
Does the Mathematics 2082 paper come with solutions?
Yes. Every question on this Mathematics past paper includes a step-by-step solution, plus instant AI feedback when you attempt it on Kekkei.
How many marks is the NEB Class 12 Mathematics 2082 paper?
The NEB Class 12 Mathematics 2082 paper carries 75 full marks and is meant to be completed in 180 minutes, across 29 questions.
Is practising this Mathematics past paper free?
Yes — reading and attempting this Mathematics past paper on Kekkei is completely free.